C18H16F3NO5S — CID 154243496
2-(acetylsulfanylmethyl)-6-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 154243496) has the molecular formula C18H16F3NO5S and a molecular weight of 415.39 g/mol. Its IUPAC name is 2-(acetylsulfanylmethyl)-6-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 2-(acetylsulfanylmethyl)-6-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 154243496 |
| Molecular Formula | C18H16F3NO5S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 2-(acetylsulfanylmethyl)-6-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC(=O)SCC1=C(C(=O)O)C(c2ccccc2C(F)(F)F)C(C(=O)O)=C(C)N1 |
| InChI | InChI=1S/C18H16F3NO5S/c1-8-13(16(24)25)14(10-5-3-4-6-11(10)18(19,20)21)15(17(26)27)12(22-8)7-28-9(2)23/h3-6,14,22H,7H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | YNHZMPPPLXBRCE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|