C9H15N5O — CID 154243833
2-amino-6-ethyl-6-methyl-3,5,7,8-tetrahydropteridin-4-one (PubChem CID 154243833) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-amino-6-ethyl-6-methyl-3,5,7,8-tetrahydropteridin-4-one.
| Compound Name | 2-amino-6-ethyl-6-methyl-3,5,7,8-tetrahydropteridin-4-one |
|---|---|
| PubChem CID | 154243833 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-amino-6-ethyl-6-methyl-3,5,7,8-tetrahydropteridin-4-one |
| SMILES | CCC1(C)CNc2nc(N)[nH]c(=O)c2N1 |
| InChI | InChI=1S/C9H15N5O/c1-3-9(2)4-11-6-5(14-9)7(15)13-8(10)12-6/h14H,3-4H2,1-2H3,(H4,10,11,12,13,15) |
| InChIKey | BMZKPOOSUZXMNO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |