C16H27NO4 — CID 15424599
[(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-[(5S)-5-ethyl-4-methyl-2H-furan-5-yl]methanone (PubChem CID 15424599) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is [(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-[(5S)-5-ethyl-4-methyl-2H-furan-5-yl]methanone.
| Compound Name | [(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-[(5S)-5-ethyl-4-methyl-2H-furan-5-yl]methanone |
|---|---|
| PubChem CID | 15424599 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | [(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-[(5S)-5-ethyl-4-methyl-2H-furan-5-yl]methanone |
| SMILES | CC[C@]1(C(=O)N2[C@H](COC)CC[C@H]2COC)OCC=C1C |
| InChI | InChI=1S/C16H27NO4/c1-5-16(12(2)8-9-21-16)15(18)17-13(10-19-3)6-7-14(17)11-20-4/h8,13-14H,5-7,9-11H2,1-4H3/t13-,14-,16-/m0/s1 |
| InChIKey | FLPAJSXOKNQNLL-DZKIICNBSA-N |
| XLogP | 1.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|