About 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole
1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole (PubChem CID 154248512) has the molecular formula C14H7Cl2F3N2O2S
and a molecular weight of 395.19 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole |
| PubChem CID | 154248512 |
| Molecular Formula | C14H7Cl2F3N2O2S |
| Molecular Weight | 395.19 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole |
| SMILES | O=S(=O)(c1ccccc1)n1c(C(F)(F)F)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C14H7Cl2F3N2O2S/c15-9-6-11-12(7-10(9)16)21(13(20-11)14(17,18)19)24(22,23)8-4-2-1-3-5-8/h1-7H |
| InChIKey | SCULGSABYQORFM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.19 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole?
The IUPAC name of 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole (CID 154248512) is 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole.
What is the SMILES notation for 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole?
The canonical SMILES for 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole is O=S(=O)(c1ccccc1)n1c(C(F)(F)F)nc2cc(Cl)c(Cl)cc21.
What is the InChIKey of 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole?
The InChIKey is SCULGSABYQORFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7Cl2F3N2O2S/c15-9-6-11-12(7-10(9)16)21(13(20-11)14(17,18)19)24(22,23)8-4-2-1-3-5-8/h1-7H.
What are the key properties of 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole?
1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole has a molecular weight of 395.19 g/mol, XLogP of 4.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-5,6-dichloro-2-(trifluoromethyl)benzimidazole is sourced from PubChem (CID 154248512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).