C15H14F18O2 — CID 15425011
1,1,1,2,3,3-hexafluoro-4,5-bis(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentane (PubChem CID 15425011) has the molecular formula C15H14F18O2 and a molecular weight of 568.24 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-4,5-bis(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-4,5-bis(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentane |
|---|---|
| PubChem CID | 15425011 |
| Molecular Formula | C15H14F18O2 |
| Molecular Weight | 568.24 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-4,5-bis(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentane |
| SMILES | CC(OCC(OC(C)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C15H14F18O2/c1-4(10(19,20)7(16)13(25,26)27)34-3-6(12(23,24)9(18)15(31,32)33)35-5(2)11(21,22)8(17)14(28,29)30/h4-9H,3H2,1-2H3 |
| InChIKey | ZEYFIASTMTZDMR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.24 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |