C26H26N2O3S — CID 15425134
3',3'-dimethyl-6-nitro-1'-(4-thiophen-2-ylbutyl)spiro[chromene-2,2'-indole] (PubChem CID 15425134) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is 3',3'-dimethyl-6-nitro-1'-(4-thiophen-2-ylbutyl)spiro[chromene-2,2'-indole].
| Compound Name | 3',3'-dimethyl-6-nitro-1'-(4-thiophen-2-ylbutyl)spiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 15425134 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 3',3'-dimethyl-6-nitro-1'-(4-thiophen-2-ylbutyl)spiro[chromene-2,2'-indole] |
| SMILES | CC1(C)c2ccccc2N(CCCCc2cccs2)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C26H26N2O3S/c1-25(2)22-10-3-4-11-23(22)27(16-6-5-8-21-9-7-17-32-21)26(25)15-14-19-18-20(28(29)30)12-13-24(19)31-26/h3-4,7,9-15,17-18H,5-6,8,16H2,1-2H3 |
| InChIKey | QCXUBQDSIMJZLB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|