C10H11N3O3 — CID 154253325
1,3,6-trimethylpyrido[4,3-d]pyrimidine-2,4,7-trione (PubChem CID 154253325) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 1,3,6-trimethylpyrido[4,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 1,3,6-trimethylpyrido[4,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 154253325 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 1,3,6-trimethylpyrido[4,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1cc2c(=O)n(C)c(=O)n(C)c2cc1=O |
| InChI | InChI=1S/C10H11N3O3/c1-11-5-6-7(4-8(11)14)12(2)10(16)13(3)9(6)15/h4-5H,1-3H3 |
| InChIKey | CKTGVUGAPLNYNZ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |