About 5-butyl-4-ethoxy-2,6-dimethylpyrimidine
5-butyl-4-ethoxy-2,6-dimethylpyrimidine (PubChem CID 15425429) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-butyl-4-ethoxy-2,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 5-butyl-4-ethoxy-2,6-dimethylpyrimidine |
| PubChem CID | 15425429 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 5-butyl-4-ethoxy-2,6-dimethylpyrimidine |
| SMILES | CCCCc1c(C)nc(C)nc1OCC |
| InChI | InChI=1S/C12H20N2O/c1-5-7-8-11-9(3)13-10(4)14-12(11)15-6-2/h5-8H2,1-4H3 |
| InChIKey | CDHCBDNMKXGTCR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butyl-4-ethoxy-2,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-4-ethoxy-2,6-dimethylpyrimidine?
The IUPAC name of 5-butyl-4-ethoxy-2,6-dimethylpyrimidine (CID 15425429) is 5-butyl-4-ethoxy-2,6-dimethylpyrimidine.
What is the SMILES notation for 5-butyl-4-ethoxy-2,6-dimethylpyrimidine?
The canonical SMILES for 5-butyl-4-ethoxy-2,6-dimethylpyrimidine is CCCCc1c(C)nc(C)nc1OCC.
What is the InChIKey of 5-butyl-4-ethoxy-2,6-dimethylpyrimidine?
The InChIKey is CDHCBDNMKXGTCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-5-7-8-11-9(3)13-10(4)14-12(11)15-6-2/h5-8H2,1-4H3.
What are the key properties of 5-butyl-4-ethoxy-2,6-dimethylpyrimidine?
5-butyl-4-ethoxy-2,6-dimethylpyrimidine has a molecular weight of 208.30 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-4-ethoxy-2,6-dimethylpyrimidine is sourced from PubChem (CID 15425429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).