C24H18N2O — CID 15425453
14-phenyl-10,15-diazapentacyclo[11.6.1.02,10.03,8.016,20]icosa-1(20),3,5,7,13,16,18-heptaen-9-one (PubChem CID 15425453) has the molecular formula C24H18N2O and a molecular weight of 350.42 g/mol. Its IUPAC name is 14-phenyl-10,15-diazapentacyclo[11.6.1.02,10.03,8.016,20]icosa-1(20),3,5,7,13,16,18-heptaen-9-one.
| Compound Name | 14-phenyl-10,15-diazapentacyclo[11.6.1.02,10.03,8.016,20]icosa-1(20),3,5,7,13,16,18-heptaen-9-one |
|---|---|
| PubChem CID | 15425453 |
| Molecular Formula | C24H18N2O |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 14-phenyl-10,15-diazapentacyclo[11.6.1.02,10.03,8.016,20]icosa-1(20),3,5,7,13,16,18-heptaen-9-one |
| SMILES | O=C1c2ccccc2C2c3cccc4[nH]c(-c5ccccc5)c(c34)CCN12 |
| InChI | InChI=1S/C24H18N2O/c27-24-17-10-5-4-9-16(17)23-19-11-6-12-20-21(19)18(13-14-26(23)24)22(25-20)15-7-2-1-3-8-15/h1-12,23,25H,13-14H2 |
| InChIKey | DLDCOJMBSHKEIN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |