C28H33F3N6O3 — CID 154255513
1-(5-amino-5-oxopentyl)-2-benzyl-4-[(5-pyrazin-2-ylfuran-2-yl)methyl]-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide (PubChem CID 154255513) has the molecular formula C28H33F3N6O3 and a molecular weight of 558.61 g/mol. Its IUPAC name is 1-(5-amino-5-oxopentyl)-2-benzyl-4-[(5-pyrazin-2-ylfuran-2-yl)methyl]-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide.
| Compound Name | 1-(5-amino-5-oxopentyl)-2-benzyl-4-[(5-pyrazin-2-ylfuran-2-yl)methyl]-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 154255513 |
| Molecular Formula | C28H33F3N6O3 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 1-(5-amino-5-oxopentyl)-2-benzyl-4-[(5-pyrazin-2-ylfuran-2-yl)methyl]-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide |
| SMILES | NC(=O)CCCCN1CCN(Cc2ccc(-c3cnccn3)o2)CC1(Cc1ccccc1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C28H33F3N6O3/c29-28(30,31)19-35-26(39)27(16-21-6-2-1-3-7-21)20-36(14-15-37(27)13-5-4-8-25(32)38)18-22-9-10-24(40-22)23-17-33-11-12-34-23/h1-3,6-7,9-12,17H,4-5,8,13-16,18-20H2,(H2,32,38)(H,35,39) |
| InChIKey | NHUMGDBEOJKVOM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|