About 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile
2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile (PubChem CID 15425578) has the molecular formula C12H8ClN5OS
and a molecular weight of 305.75 g/mol. Its IUPAC name is 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile.
Molecular Properties
| Compound Name | 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile |
| PubChem CID | 15425578 |
| Molecular Formula | C12H8ClN5OS |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1sc(N2CCOCC2)nc1Cl |
| InChI | InChI=1S/C12H8ClN5OS/c13-11-10(9(7-16)8(5-14)6-15)20-12(17-11)18-1-3-19-4-2-18/h1-4H2 |
| InChIKey | PSWXNWXGJVQZJG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 96.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile?
The IUPAC name of 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile (CID 15425578) is 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile.
What is the SMILES notation for 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile?
The canonical SMILES for 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile is N#CC(C#N)=C(C#N)c1sc(N2CCOCC2)nc1Cl.
What is the InChIKey of 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile?
The InChIKey is PSWXNWXGJVQZJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClN5OS/c13-11-10(9(7-16)8(5-14)6-15)20-12(17-11)18-1-3-19-4-2-18/h1-4H2.
What are the key properties of 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile?
2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile has a molecular weight of 305.75 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile is sourced from PubChem (CID 15425578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).