About 4-amino-3-benzyl-2H-1,2-oxazol-5-one
4-amino-3-benzyl-2H-1,2-oxazol-5-one (PubChem CID 154256799) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 4-amino-3-benzyl-2H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 4-amino-3-benzyl-2H-1,2-oxazol-5-one |
| PubChem CID | 154256799 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 4-amino-3-benzyl-2H-1,2-oxazol-5-one |
| SMILES | Nc1c(Cc2ccccc2)[nH]oc1=O |
| InChI | InChI=1S/C10H10N2O2/c11-9-8(12-14-10(9)13)6-7-4-2-1-3-5-7/h1-5,12H,6,11H2 |
| InChIKey | IFYYICNAZXBLPQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-3-benzyl-2H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-benzyl-2H-1,2-oxazol-5-one?
The IUPAC name of 4-amino-3-benzyl-2H-1,2-oxazol-5-one (CID 154256799) is 4-amino-3-benzyl-2H-1,2-oxazol-5-one.
What is the SMILES notation for 4-amino-3-benzyl-2H-1,2-oxazol-5-one?
The canonical SMILES for 4-amino-3-benzyl-2H-1,2-oxazol-5-one is Nc1c(Cc2ccccc2)[nH]oc1=O.
What is the InChIKey of 4-amino-3-benzyl-2H-1,2-oxazol-5-one?
The InChIKey is IFYYICNAZXBLPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c11-9-8(12-14-10(9)13)6-7-4-2-1-3-5-7/h1-5,12H,6,11H2.
What are the key properties of 4-amino-3-benzyl-2H-1,2-oxazol-5-one?
4-amino-3-benzyl-2H-1,2-oxazol-5-one has a molecular weight of 190.20 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-benzyl-2H-1,2-oxazol-5-one is sourced from PubChem (CID 154256799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).