About 2-(hexadecylamino)phenol
2-(hexadecylamino)phenol (PubChem CID 154256819) has the molecular formula C22H39NO
and a molecular weight of 333.56 g/mol. Its IUPAC name is 2-(hexadecylamino)phenol.
Molecular Properties
| Compound Name | 2-(hexadecylamino)phenol |
| PubChem CID | 154256819 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | 2-(hexadecylamino)phenol |
| SMILES | CCCCCCCCCCCCCCCCNc1ccccc1O |
| InChI | InChI=1S/C22H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20-23-21-18-15-16-19-22(21)24/h15-16,18-19,23-24H,2-14,17,20H2,1H3 |
| InChIKey | MAYPYKPBUZARFY-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-(hexadecylamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hexadecylamino)phenol?
The IUPAC name of 2-(hexadecylamino)phenol (CID 154256819) is 2-(hexadecylamino)phenol.
What is the SMILES notation for 2-(hexadecylamino)phenol?
The canonical SMILES for 2-(hexadecylamino)phenol is CCCCCCCCCCCCCCCCNc1ccccc1O.
What is the InChIKey of 2-(hexadecylamino)phenol?
The InChIKey is MAYPYKPBUZARFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20-23-21-18-15-16-19-22(21)24/h15-16,18-19,23-24H,2-14,17,20H2,1H3.
What are the key properties of 2-(hexadecylamino)phenol?
2-(hexadecylamino)phenol has a molecular weight of 333.56 g/mol, XLogP of 7.29, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hexadecylamino)phenol is sourced from PubChem (CID 154256819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).