C17H24O7 — CID 15425726
methyl (1S,2S,6S,7R)-4,10,10-trimethoxy-2,4-dimethyl-11-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-9-carboxylate (PubChem CID 15425726) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is methyl (1S,2S,6S,7R)-4,10,10-trimethoxy-2,4-dimethyl-11-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-9-carboxylate.
| Compound Name | methyl (1S,2S,6S,7R)-4,10,10-trimethoxy-2,4-dimethyl-11-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-9-carboxylate |
|---|---|
| PubChem CID | 15425726 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | methyl (1S,2S,6S,7R)-4,10,10-trimethoxy-2,4-dimethyl-11-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-9-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2C(=O)C(OC)(OC)[C@@H]1[C@@]1(C)OC(C)(OC)C[C@@H]21 |
| InChI | InChI=1S/C17H24O7/c1-15(21-4)8-11-9-7-10(14(19)20-3)12(16(11,2)24-15)17(22-5,23-6)13(9)18/h7,9,11-12H,8H2,1-6H3/t9-,11+,12+,15?,16+/m1/s1 |
| InChIKey | LVFLIYCCSAPIRL-XBPAUHGBSA-N |
| XLogP | 1.06 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|