About 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid
3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 154257673) has the molecular formula C13H21N3O3
and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 154257673 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCCCCC1(C(=O)O)C=C(N=C(N)N)C=CC1O |
| InChI | InChI=1S/C13H21N3O3/c1-2-3-4-7-13(11(18)19)8-9(16-12(14)15)5-6-10(13)17/h5-6,8,10,17H,2-4,7H2,1H3,(H,18,19)(H4,14,15,16) |
| InChIKey | WGOHSXFRYSJJHM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid (CID 154257673) is 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid is CCCCCC1(C(=O)O)C=C(N=C(N)N)C=CC1O.
What is the InChIKey of 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is WGOHSXFRYSJJHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O3/c1-2-3-4-7-13(11(18)19)8-9(16-12(14)15)5-6-10(13)17/h5-6,8,10,17H,2-4,7H2,1H3,(H,18,19)(H4,14,15,16).
What are the key properties of 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid?
3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 267.33 g/mol, XLogP of 0.73, 6 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diaminomethylideneamino)-6-hydroxy-1-pentylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 154257673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).