C17H13F2NO3 — CID 154257924
1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione (PubChem CID 154257924) has the molecular formula C17H13F2NO3 and a molecular weight of 317.29 g/mol. Its IUPAC name is 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione.
| Compound Name | 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 154257924 |
| Molecular Formula | C17H13F2NO3 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione |
| SMILES | CC(F)(F)CNc1ccc(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H13F2NO3/c1-17(18,19)8-20-11-6-7-12(21)14-13(11)15(22)9-4-2-3-5-10(9)16(14)23/h2-7,20-21H,8H2,1H3 |
| InChIKey | PGAIDZQGSLAXNU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|