About 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione
1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione (PubChem CID 154257924) has the molecular formula C17H13F2NO3
and a molecular weight of 317.29 g/mol. Its IUPAC name is 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione.
Molecular Properties
| Compound Name | 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione |
| PubChem CID | 154257924 |
| Molecular Formula | C17H13F2NO3 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione |
| SMILES | CC(F)(F)CNc1ccc(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H13F2NO3/c1-17(18,19)8-20-11-6-7-12(21)14-13(11)15(22)9-4-2-3-5-10(9)16(14)23/h2-7,20-21H,8H2,1H3 |
| InChIKey | PGAIDZQGSLAXNU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione?
The IUPAC name of 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione (CID 154257924) is 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione.
What is the SMILES notation for 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione?
The canonical SMILES for 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione is CC(F)(F)CNc1ccc(O)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione?
The InChIKey is PGAIDZQGSLAXNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2NO3/c1-17(18,19)8-20-11-6-7-12(21)14-13(11)15(22)9-4-2-3-5-10(9)16(14)23/h2-7,20-21H,8H2,1H3.
What are the key properties of 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione?
1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione has a molecular weight of 317.29 g/mol, XLogP of 3.23, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoropropylamino)-4-hydroxyanthracene-9,10-dione is sourced from PubChem (CID 154257924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).