C20H12ClN3O3 — CID 15425881
13-amino-11-(4-chlorophenyl)-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12,14,16-heptaen-9-one (PubChem CID 15425881) has the molecular formula C20H12ClN3O3 and a molecular weight of 377.79 g/mol. Its IUPAC name is 13-amino-11-(4-chlorophenyl)-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12,14,16-heptaen-9-one.
| Compound Name | 13-amino-11-(4-chlorophenyl)-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12,14,16-heptaen-9-one |
|---|---|
| PubChem CID | 15425881 |
| Molecular Formula | C20H12ClN3O3 |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 13-amino-11-(4-chlorophenyl)-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12,14,16-heptaen-9-one |
| SMILES | Nc1ncnc2c1C(c1ccc(Cl)cc1)c1c(c3ccccc3oc1=O)O2 |
| InChI | InChI=1S/C20H12ClN3O3/c21-11-7-5-10(6-8-11)14-15-17(27-19-16(14)18(22)23-9-24-19)12-3-1-2-4-13(12)26-20(15)25/h1-9,14H,(H2,22,23,24) |
| InChIKey | RUBXNTHZFIKIPY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|