C20H38O7S — CID 15426
1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid (PubChem CID 15426) has the molecular formula C20H38O7S and a molecular weight of 422.58 g/mol. Its IUPAC name is 1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | 1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 15426 |
| Molecular Formula | C20H38O7S |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid |
| SMILES | CCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)S(=O)(=O)O |
| InChI | InChI=1S/C20H38O7S/c1-3-5-7-9-11-13-15-26-19(21)17-18(28(23,24)25)20(22)27-16-14-12-10-8-6-4-2/h18H,3-17H2,1-2H3,(H,23,24,25) |
| InChIKey | OXLXSOPFNVKUMU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|