About 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine
4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine (PubChem CID 154261194) has the molecular formula C11H27ClN2Si
and a molecular weight of 250.89 g/mol. Its IUPAC name is 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine.
Molecular Properties
| Compound Name | 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine |
| PubChem CID | 154261194 |
| Molecular Formula | C11H27ClN2Si |
| Molecular Weight | 250.89 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine |
| SMILES | CCN(CC)CC(CCCl)N[Si](C)(C)C |
| InChI | InChI=1S/C11H27ClN2Si/c1-6-14(7-2)10-11(8-9-12)13-15(3,4)5/h11,13H,6-10H2,1-5H3 |
| InChIKey | UBWJDVNOWDGHQO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.89 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine?
The IUPAC name of 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine (CID 154261194) is 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine.
What is the SMILES notation for 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine?
The canonical SMILES for 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine is CCN(CC)CC(CCCl)N[Si](C)(C)C.
What is the InChIKey of 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine?
The InChIKey is UBWJDVNOWDGHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27ClN2Si/c1-6-14(7-2)10-11(8-9-12)13-15(3,4)5/h11,13H,6-10H2,1-5H3.
What are the key properties of 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine?
4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine has a molecular weight of 250.89 g/mol, XLogP of 2.75, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-N,1-N-diethyl-2-N-trimethylsilylbutane-1,2-diamine is sourced from PubChem (CID 154261194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).