C28H52O4Si — CID 15426172
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methyl-2-[(Z)-4-tri(propan-2-yl)silyloxybut-2-enoxy]but-2-enoate (PubChem CID 15426172) has the molecular formula C28H52O4Si and a molecular weight of 480.81 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methyl-2-[(Z)-4-tri(propan-2-yl)silyloxybut-2-enoxy]but-2-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methyl-2-[(Z)-4-tri(propan-2-yl)silyloxybut-2-enoxy]but-2-enoate |
|---|---|
| PubChem CID | 15426172 |
| Molecular Formula | C28H52O4Si |
| Molecular Weight | 480.81 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methyl-2-[(Z)-4-tri(propan-2-yl)silyloxybut-2-enoxy]but-2-enoate |
| SMILES | CC(C)=C(OC/C=C\CO[Si](C(C)C)(C(C)C)C(C)C)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C28H52O4Si/c1-19(2)25-15-14-24(11)18-26(25)32-28(29)27(20(3)4)30-16-12-13-17-31-33(21(5)6,22(7)8)23(9)10/h12-13,19,21-26H,14-18H2,1-11H3/b13-12-/t24-,25+,26-/m1/s1 |
| InChIKey | WJYQVEXNJUUQOC-IXAXVPERSA-N |
| XLogP | 8.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.81 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|