About N,N,4-trimethyl-1,2-oxazole-3-carboxamide
N,N,4-trimethyl-1,2-oxazole-3-carboxamide (PubChem CID 154265321) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is N,N,4-trimethyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N,N,4-trimethyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 154265321 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | N,N,4-trimethyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1conc1C(=O)N(C)C |
| InChI | InChI=1S/C7H10N2O2/c1-5-4-11-8-6(5)7(10)9(2)3/h4H,1-3H3 |
| InChIKey | PCYXWDWNHYDBSS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N,4-trimethyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,4-trimethyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N,N,4-trimethyl-1,2-oxazole-3-carboxamide (CID 154265321) is N,N,4-trimethyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N,N,4-trimethyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N,N,4-trimethyl-1,2-oxazole-3-carboxamide is Cc1conc1C(=O)N(C)C.
What is the InChIKey of N,N,4-trimethyl-1,2-oxazole-3-carboxamide?
The InChIKey is PCYXWDWNHYDBSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-5-4-11-8-6(5)7(10)9(2)3/h4H,1-3H3.
What are the key properties of N,N,4-trimethyl-1,2-oxazole-3-carboxamide?
N,N,4-trimethyl-1,2-oxazole-3-carboxamide has a molecular weight of 154.17 g/mol, XLogP of 0.68, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,4-trimethyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 154265321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).