C8H11F3N2O2 — CID 154265681
1-(1,1,1-trifluoropentan-3-yl)imidazolidine-2,4-dione (PubChem CID 154265681) has the molecular formula C8H11F3N2O2 and a molecular weight of 224.18 g/mol. Its IUPAC name is 1-(1,1,1-trifluoropentan-3-yl)imidazolidine-2,4-dione.
| Compound Name | 1-(1,1,1-trifluoropentan-3-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154265681 |
| Molecular Formula | C8H11F3N2O2 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-(1,1,1-trifluoropentan-3-yl)imidazolidine-2,4-dione |
| SMILES | CCC(CC(F)(F)F)N1CC(=O)NC1=O |
| InChI | InChI=1S/C8H11F3N2O2/c1-2-5(3-8(9,10)11)13-4-6(14)12-7(13)15/h5H,2-4H2,1H3,(H,12,14,15) |
| InChIKey | BCURKENBMISIHB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|