About 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene
3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene (PubChem CID 154267175) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene.
Molecular Properties
| Compound Name | 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene |
| PubChem CID | 154267175 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene |
| SMILES | CC1(C)CC=CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C11H17NO/c1-10(2)5-4-6-11(3,7-10)8-12-9-13/h4,6H,5,7-8H2,1-3H3 |
| InChIKey | OMZJLPNCBLYISA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene?
The IUPAC name of 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene (CID 154267175) is 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene.
What is the SMILES notation for 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene?
The canonical SMILES for 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene is CC1(C)CC=CC(C)(CN=C=O)C1.
What is the InChIKey of 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene?
The InChIKey is OMZJLPNCBLYISA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-10(2)5-4-6-11(3,7-10)8-12-9-13/h4,6H,5,7-8H2,1-3H3.
What are the key properties of 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene?
3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene has a molecular weight of 179.26 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexene is sourced from PubChem (CID 154267175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).