C13H17ClN4 — CID 154268218
1-(5-chlorobenzotriazol-2-yl)-2,4-dimethylpent-3-en-2-amine (PubChem CID 154268218) has the molecular formula C13H17ClN4 and a molecular weight of 264.76 g/mol. Its IUPAC name is 1-(5-chlorobenzotriazol-2-yl)-2,4-dimethylpent-3-en-2-amine.
| Compound Name | 1-(5-chlorobenzotriazol-2-yl)-2,4-dimethylpent-3-en-2-amine |
|---|---|
| PubChem CID | 154268218 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-(5-chlorobenzotriazol-2-yl)-2,4-dimethylpent-3-en-2-amine |
| SMILES | CC(C)=CC(C)(N)Cn1nc2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C13H17ClN4/c1-9(2)7-13(3,15)8-18-16-11-5-4-10(14)6-12(11)17-18/h4-7H,8,15H2,1-3H3 |
| InChIKey | GYJIFWPJPYEVPE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|