C12H7F3N4 — CID 154268588
5-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 154268588) has the molecular formula C12H7F3N4 and a molecular weight of 264.21 g/mol. Its IUPAC name is 5-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 5-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 154268588 |
| Molecular Formula | C12H7F3N4 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Nc1nc2cccc(-c3ccc(F)c(F)c3F)n2n1 |
| InChI | InChI=1S/C12H7F3N4/c13-7-5-4-6(10(14)11(7)15)8-2-1-3-9-17-12(16)18-19(8)9/h1-5H,(H2,16,18) |
| InChIKey | FMUVLOLSARCVAV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|