C41H78O6Si3 — CID 154272446
12-[6-[3-[4,4,4-tris(triethylsilyloxy)butyl]oxiran-2-yl]hexa-1,3-dienyl]-1-oxacyclododec-9-en-2-one (PubChem CID 154272446) has the molecular formula C41H78O6Si3 and a molecular weight of 751.33 g/mol. Its IUPAC name is 12-[6-[3-[4,4,4-tris(triethylsilyloxy)butyl]oxiran-2-yl]hexa-1,3-dienyl]-1-oxacyclododec-9-en-2-one.
| Compound Name | 12-[6-[3-[4,4,4-tris(triethylsilyloxy)butyl]oxiran-2-yl]hexa-1,3-dienyl]-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 154272446 |
| Molecular Formula | C41H78O6Si3 |
| Molecular Weight | 751.33 g/mol |
| Exact Mass | 750.51 |
| IUPAC Name | 12-[6-[3-[4,4,4-tris(triethylsilyloxy)butyl]oxiran-2-yl]hexa-1,3-dienyl]-1-oxacyclododec-9-en-2-one |
| SMILES | CC[Si](CC)(CC)OC(CCCC1OC1CCC=CC=CC1CC=CCCCCCCC(=O)O1)(O[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C41H78O6Si3/c1-10-48(11-2,12-3)45-41(46-49(13-4,14-5)15-6,47-50(16-7,17-8)18-9)36-30-34-39-38(44-39)33-28-25-24-27-32-37-31-26-22-20-19-21-23-29-35-40(42)43-37/h22,24-27,32,37-39H,10-21,23,28-31,33-36H2,1-9H3 |
| InChIKey | IWGFPRKJXKOOFB-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.33 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|