About 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate
1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate (PubChem CID 15427330) has the molecular formula C12H19SSe-
and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate.
Molecular Properties
| Compound Name | 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate |
| PubChem CID | 15427330 |
| Molecular Formula | C12H19SSe- |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate |
| SMILES | C=CCC(CC=C)=C([Se-])SCCCC |
| InChI | InChI=1S/C12H20SSe/c1-4-7-10-13-12(14)11(8-5-2)9-6-3/h5-6,14H,2-4,7-10H2,1H3/p-1 |
| InChIKey | VPLZILOJBBIYHB-UHFFFAOYSA-M |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate?
The IUPAC name of 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate (CID 15427330) is 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate.
What is the SMILES notation for 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate?
The canonical SMILES for 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate is C=CCC(CC=C)=C([Se-])SCCCC.
What is the InChIKey of 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate?
The InChIKey is VPLZILOJBBIYHB-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H20SSe/c1-4-7-10-13-12(14)11(8-5-2)9-6-3/h5-6,14H,2-4,7-10H2,1H3/p-1.
What are the key properties of 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate?
1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate has a molecular weight of 274.31 g/mol, XLogP of 4.05, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfanyl-2-prop-2-enylpenta-1,4-diene-1-selenolate is sourced from PubChem (CID 15427330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).