About N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide
N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide (PubChem CID 154274339) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide |
| PubChem CID | 154274339 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CC(=O)N(O)C1=O |
| InChI | InChI=1S/C6H8N2O4/c1-3(9)7-4-2-5(10)8(12)6(4)11/h4,12H,2H2,1H3,(H,7,9)/t4-/m1/s1 |
| InChIKey | OTKGBSPJCMROIF-SCSAIBSYSA-N |
| XLogP | -1.36 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide?
The IUPAC name of N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide (CID 154274339) is N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide.
What is the SMILES notation for N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide?
The canonical SMILES for N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide is CC(=O)N[C@@H]1CC(=O)N(O)C1=O.
What is the InChIKey of N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide?
The InChIKey is OTKGBSPJCMROIF-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H8N2O4/c1-3(9)7-4-2-5(10)8(12)6(4)11/h4,12H,2H2,1H3,(H,7,9)/t4-/m1/s1.
What are the key properties of N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide?
N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide has a molecular weight of 172.14 g/mol, XLogP of -1.36, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl]acetamide is sourced from PubChem (CID 154274339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).