C9H15NO3 — CID 15427513
(8R,8aS)-8a-hydroxy-8-(hydroxymethyl)-1,2,5,6,7,8-hexahydroindolizin-3-one (PubChem CID 15427513) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (8R,8aS)-8a-hydroxy-8-(hydroxymethyl)-1,2,5,6,7,8-hexahydroindolizin-3-one.
| Compound Name | (8R,8aS)-8a-hydroxy-8-(hydroxymethyl)-1,2,5,6,7,8-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 15427513 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (8R,8aS)-8a-hydroxy-8-(hydroxymethyl)-1,2,5,6,7,8-hexahydroindolizin-3-one |
| SMILES | O=C1CC[C@]2(O)[C@@H](CO)CCCN12 |
| InChI | InChI=1S/C9H15NO3/c11-6-7-2-1-5-10-8(12)3-4-9(7,10)13/h7,11,13H,1-6H2/t7-,9+/m1/s1 |
| InChIKey | KGZRZIXNTTZVCN-APPZFPTMSA-N |
| XLogP | -0.30 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |