About 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid
3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid (PubChem CID 15427540) has the molecular formula C25H33NO5
and a molecular weight of 427.54 g/mol. Its IUPAC name is 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid.
Molecular Properties
| Compound Name | 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid |
| PubChem CID | 15427540 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid |
| SMILES | CCCCN(CCCC)C(=O)COC(c1ccccc1)(c1ccccc1)C(O)C(=O)O |
| InChI | InChI=1S/C25H33NO5/c1-3-5-17-26(18-6-4-2)22(27)19-31-25(23(28)24(29)30,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,23,28H,3-6,17-19H2,1-2H3,(H,29,30) |
| InChIKey | RVVNFIPTJIVKKJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid?
The IUPAC name of 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid (CID 15427540) is 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid.
What is the SMILES notation for 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid?
The canonical SMILES for 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid is CCCCN(CCCC)C(=O)COC(c1ccccc1)(c1ccccc1)C(O)C(=O)O.
What is the InChIKey of 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid?
The InChIKey is RVVNFIPTJIVKKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33NO5/c1-3-5-17-26(18-6-4-2)22(27)19-31-25(23(28)24(29)30,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,23,28H,3-6,17-19H2,1-2H3,(H,29,30).
What are the key properties of 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid?
3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid has a molecular weight of 427.54 g/mol, XLogP of 3.82, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoic acid is sourced from PubChem (CID 15427540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).