C5H2F7NS — CID 154277019
2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetonitrile (PubChem CID 154277019) has the molecular formula C5H2F7NS and a molecular weight of 241.13 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetonitrile.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetonitrile |
|---|---|
| PubChem CID | 154277019 |
| Molecular Formula | C5H2F7NS |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetonitrile |
| SMILES | N#CCSC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H2F7NS/c6-3(7,4(8,9)10)5(11,12)14-2-1-13/h2H2 |
| InChIKey | UWEJESDQLOFVGO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|