C14H19P — CID 154277815
7-cyclohepta-1,3-dien-1-yl-1-methyl-2,3-dihydrophosphepine (PubChem CID 154277815) has the molecular formula C14H19P and a molecular weight of 218.28 g/mol. Its IUPAC name is 7-cyclohepta-1,3-dien-1-yl-1-methyl-2,3-dihydrophosphepine.
| Compound Name | 7-cyclohepta-1,3-dien-1-yl-1-methyl-2,3-dihydrophosphepine |
|---|---|
| PubChem CID | 154277815 |
| Molecular Formula | C14H19P |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 7-cyclohepta-1,3-dien-1-yl-1-methyl-2,3-dihydrophosphepine |
| SMILES | CP1CCC=CC=C1C1=CC=CCCC1 |
| InChI | InChI=1S/C14H19P/c1-15-12-8-4-7-11-14(15)13-9-5-2-3-6-10-13/h2,4-5,7,9,11H,3,6,8,10,12H2,1H3 |
| InChIKey | CDXKVHVBGUKUBA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|