C8H16N2O3S — CID 15427835
1-amino-N-butylsulfonylcyclopropane-1-carboxamide (PubChem CID 15427835) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is 1-amino-N-butylsulfonylcyclopropane-1-carboxamide.
| Compound Name | 1-amino-N-butylsulfonylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 15427835 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1-amino-N-butylsulfonylcyclopropane-1-carboxamide |
| SMILES | CCCCS(=O)(=O)NC(=O)C1(N)CC1 |
| InChI | InChI=1S/C8H16N2O3S/c1-2-3-6-14(12,13)10-7(11)8(9)4-5-8/h2-6,9H2,1H3,(H,10,11) |
| InChIKey | OJGGWNHMOHVREQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |