C15H27NO3 — CID 15427959
tert-butyl (4S,5S)-5-but-3-enyl-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 15427959) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is tert-butyl (4S,5S)-5-but-3-enyl-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-5-but-3-enyl-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15427959 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | tert-butyl (4S,5S)-5-but-3-enyl-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCC[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C15H27NO3/c1-8-9-10-12-11(2)16(15(6,7)18-12)13(17)19-14(3,4)5/h8,11-12H,1,9-10H2,2-7H3/t11-,12-/m0/s1 |
| InChIKey | HGRCDENABUMBEQ-RYUDHWBXSA-N |
| XLogP | 3.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|