About 3,9-dihydro-2H-furo[2,3-b]carbazole
3,9-dihydro-2H-furo[2,3-b]carbazole (PubChem CID 154280329) has the molecular formula C14H11NO
and a molecular weight of 209.25 g/mol. Its IUPAC name is 3,9-dihydro-2H-furo[2,3-b]carbazole.
Molecular Properties
| Compound Name | 3,9-dihydro-2H-furo[2,3-b]carbazole |
| PubChem CID | 154280329 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 3,9-dihydro-2H-furo[2,3-b]carbazole |
| SMILES | c1ccc2c(c1)[nH]c1cc3c(cc12)CCO3 |
| InChI | InChI=1S/C14H11NO/c1-2-4-12-10(3-1)11-7-9-5-6-16-14(9)8-13(11)15-12/h1-4,7-8,15H,5-6H2 |
| InChIKey | XQTMWUGCQZEPPC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,9-dihydro-2H-furo[2,3-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,9-dihydro-2H-furo[2,3-b]carbazole?
The IUPAC name of 3,9-dihydro-2H-furo[2,3-b]carbazole (CID 154280329) is 3,9-dihydro-2H-furo[2,3-b]carbazole.
What is the SMILES notation for 3,9-dihydro-2H-furo[2,3-b]carbazole?
The canonical SMILES for 3,9-dihydro-2H-furo[2,3-b]carbazole is c1ccc2c(c1)[nH]c1cc3c(cc12)CCO3.
What is the InChIKey of 3,9-dihydro-2H-furo[2,3-b]carbazole?
The InChIKey is XQTMWUGCQZEPPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO/c1-2-4-12-10(3-1)11-7-9-5-6-16-14(9)8-13(11)15-12/h1-4,7-8,15H,5-6H2.
What are the key properties of 3,9-dihydro-2H-furo[2,3-b]carbazole?
3,9-dihydro-2H-furo[2,3-b]carbazole has a molecular weight of 209.25 g/mol, XLogP of 3.26, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,9-dihydro-2H-furo[2,3-b]carbazole is sourced from PubChem (CID 154280329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).