About 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole
5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole (PubChem CID 154281546) has the molecular formula C12H11Cl3N6
and a molecular weight of 345.62 g/mol. Its IUPAC name is 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole.
Molecular Properties
| Compound Name | 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole |
| PubChem CID | 154281546 |
| Molecular Formula | C12H11Cl3N6 |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole |
| SMILES | CCN1NNN=C1c1cnn(-c2cccc(Cl)c2Cl)c1Cl |
| InChI | InChI=1S/C12H11Cl3N6/c1-2-20-12(17-18-19-20)7-6-16-21(11(7)15)9-5-3-4-8(13)10(9)14/h3-6,18-19H,2H2,1H3 |
| InChIKey | LPXSPYMBZUVECM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole?
The IUPAC name of 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole (CID 154281546) is 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole.
What is the SMILES notation for 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole?
The canonical SMILES for 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole is CCN1NNN=C1c1cnn(-c2cccc(Cl)c2Cl)c1Cl.
What is the InChIKey of 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole?
The InChIKey is LPXSPYMBZUVECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl3N6/c1-2-20-12(17-18-19-20)7-6-16-21(11(7)15)9-5-3-4-8(13)10(9)14/h3-6,18-19H,2H2,1H3.
What are the key properties of 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole?
5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole has a molecular weight of 345.62 g/mol, XLogP of 2.84, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-chloro-1-(2,3-dichlorophenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole is sourced from PubChem (CID 154281546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).