C8H11F7N2 — CID 154281823
1-(2,2,3,3,4,4,4-heptafluorobutyl)piperazine (PubChem CID 154281823) has the molecular formula C8H11F7N2 and a molecular weight of 268.18 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,4-heptafluorobutyl)piperazine.
| Compound Name | 1-(2,2,3,3,4,4,4-heptafluorobutyl)piperazine |
|---|---|
| PubChem CID | 154281823 |
| Molecular Formula | C8H11F7N2 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-(2,2,3,3,4,4,4-heptafluorobutyl)piperazine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)CN1CCNCC1 |
| InChI | InChI=1S/C8H11F7N2/c9-6(10,7(11,12)8(13,14)15)5-17-3-1-16-2-4-17/h16H,1-5H2 |
| InChIKey | OJGQENHCTGGTIR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|