C7H12F3NOS — CID 154281826
ethyl 3-(2,2,2-trifluoroethylsulfanyl)propanimidate (PubChem CID 154281826) has the molecular formula C7H12F3NOS and a molecular weight of 215.24 g/mol. Its IUPAC name is ethyl 3-(2,2,2-trifluoroethylsulfanyl)propanimidate.
| Compound Name | ethyl 3-(2,2,2-trifluoroethylsulfanyl)propanimidate |
|---|---|
| PubChem CID | 154281826 |
| Molecular Formula | C7H12F3NOS |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | ethyl 3-(2,2,2-trifluoroethylsulfanyl)propanimidate |
| SMILES | [H]/N=C(/CCSCC(F)(F)F)OCC |
| InChI | InChI=1S/C7H12F3NOS/c1-2-12-6(11)3-4-13-5-7(8,9)10/h11H,2-5H2,1H3/b11-6- |
| InChIKey | FWUVADDHDKMUJW-WDZFZDKYSA-N |
| XLogP | 2.69 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|