About 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone
2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone (PubChem CID 154281840) has the molecular formula C11H19N5O
and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone.
Molecular Properties
| Compound Name | 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone |
| PubChem CID | 154281840 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone |
| SMILES | NC1=NC(N)(CC(=O)N2CCCCC2)NC=C1 |
| InChI | InChI=1S/C11H19N5O/c12-9-4-5-14-11(13,15-9)8-10(17)16-6-2-1-3-7-16/h4-5,14H,1-3,6-8,13H2,(H2,12,15) |
| InChIKey | LMFGWSWARKJPQH-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone?
The IUPAC name of 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone (CID 154281840) is 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone.
What is the SMILES notation for 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone?
The canonical SMILES for 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone is NC1=NC(N)(CC(=O)N2CCCCC2)NC=C1.
What is the InChIKey of 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone?
The InChIKey is LMFGWSWARKJPQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O/c12-9-4-5-14-11(13,15-9)8-10(17)16-6-2-1-3-7-16/h4-5,14H,1-3,6-8,13H2,(H2,12,15).
What are the key properties of 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone?
2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone has a molecular weight of 237.31 g/mol, XLogP of -0.52, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-diamino-1H-pyrimidin-2-yl)-1-piperidin-1-ylethanone is sourced from PubChem (CID 154281840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).