C16H23ClN2 — CID 154282633
1-(2-chlorophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanimine (PubChem CID 154282633) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanimine.
| Compound Name | 1-(2-chlorophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanimine |
|---|---|
| PubChem CID | 154282633 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanimine |
| SMILES | CC1(C)CC(/N=C/c2ccccc2Cl)CC(C)(C)N1 |
| InChI | InChI=1S/C16H23ClN2/c1-15(2)9-13(10-16(3,4)19-15)18-11-12-7-5-6-8-14(12)17/h5-8,11,13,19H,9-10H2,1-4H3/b18-11+ |
| InChIKey | FMCQHCQHONXULF-WOJGMQOQSA-N |
| XLogP | 4.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|