About [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate
[(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate (PubChem CID 15428308) has the molecular formula C5H8N2O3
and a molecular weight of 144.13 g/mol. Its IUPAC name is [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate |
| PubChem CID | 15428308 |
| Molecular Formula | C5H8N2O3 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1NC(=O)[C@H]1N |
| InChI | InChI=1S/C5H8N2O3/c1-2(8)10-5-3(6)4(9)7-5/h3,5H,6H2,1H3,(H,7,9)/t3-,5+/m1/s1 |
| InChIKey | KTIXRADTIPRGDB-WUJLRWPWSA-N |
| XLogP | -1.67 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate?
The IUPAC name of [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate (CID 15428308) is [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate.
What is the SMILES notation for [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate?
The canonical SMILES for [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate is CC(=O)O[C@@H]1NC(=O)[C@H]1N.
What is the InChIKey of [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate?
The InChIKey is KTIXRADTIPRGDB-WUJLRWPWSA-N. The full InChI is InChI=1S/C5H8N2O3/c1-2(8)10-5-3(6)4(9)7-5/h3,5H,6H2,1H3,(H,7,9)/t3-,5+/m1/s1.
What are the key properties of [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate?
[(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate has a molecular weight of 144.13 g/mol, XLogP of -1.67, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-amino-4-oxoazetidin-2-yl] acetate is sourced from PubChem (CID 15428308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).