About (5-methylidenecyclopenta-1,3-dien-1-yl) acetate
(5-methylidenecyclopenta-1,3-dien-1-yl) acetate (PubChem CID 154283132) has the molecular formula C8H8O2
and a molecular weight of 136.15 g/mol. Its IUPAC name is (5-methylidenecyclopenta-1,3-dien-1-yl) acetate.
Molecular Properties
| Compound Name | (5-methylidenecyclopenta-1,3-dien-1-yl) acetate |
| PubChem CID | 154283132 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | (5-methylidenecyclopenta-1,3-dien-1-yl) acetate |
| SMILES | C=C1C=CC=C1OC(C)=O |
| InChI | InChI=1S/C8H8O2/c1-6-4-3-5-8(6)10-7(2)9/h3-5H,1H2,2H3 |
| InChIKey | JSTFZRRLJFEFIP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-methylidenecyclopenta-1,3-dien-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylidenecyclopenta-1,3-dien-1-yl) acetate?
The IUPAC name of (5-methylidenecyclopenta-1,3-dien-1-yl) acetate (CID 154283132) is (5-methylidenecyclopenta-1,3-dien-1-yl) acetate.
What is the SMILES notation for (5-methylidenecyclopenta-1,3-dien-1-yl) acetate?
The canonical SMILES for (5-methylidenecyclopenta-1,3-dien-1-yl) acetate is C=C1C=CC=C1OC(C)=O.
What is the InChIKey of (5-methylidenecyclopenta-1,3-dien-1-yl) acetate?
The InChIKey is JSTFZRRLJFEFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2/c1-6-4-3-5-8(6)10-7(2)9/h3-5H,1H2,2H3.
What are the key properties of (5-methylidenecyclopenta-1,3-dien-1-yl) acetate?
(5-methylidenecyclopenta-1,3-dien-1-yl) acetate has a molecular weight of 136.15 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylidenecyclopenta-1,3-dien-1-yl) acetate is sourced from PubChem (CID 154283132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).