About 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione
4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione (PubChem CID 154289735) has the molecular formula C21H24N2O6S2
and a molecular weight of 464.57 g/mol. Its IUPAC name is 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione |
| PubChem CID | 154289735 |
| Molecular Formula | C21H24N2O6S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione |
| SMILES | CCCCC1C(=O)N(c2ccc(S(C)(=O)=O)cc2)N(c2ccc(S(C)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C21H24N2O6S2/c1-4-5-6-19-20(24)22(15-7-11-17(12-8-15)30(2,26)27)23(21(19)25)16-9-13-18(14-10-16)31(3,28)29/h7-14,19H,4-6H2,1-3H3 |
| InChIKey | QITHIRYPSBQLLV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione?
The IUPAC name of 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione (CID 154289735) is 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione.
What is the SMILES notation for 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione?
The canonical SMILES for 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione is CCCCC1C(=O)N(c2ccc(S(C)(=O)=O)cc2)N(c2ccc(S(C)(=O)=O)cc2)C1=O.
What is the InChIKey of 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione?
The InChIKey is QITHIRYPSBQLLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O6S2/c1-4-5-6-19-20(24)22(15-7-11-17(12-8-15)30(2,26)27)23(21(19)25)16-9-13-18(14-10-16)31(3,28)29/h7-14,19H,4-6H2,1-3H3.
What are the key properties of 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione?
4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione has a molecular weight of 464.57 g/mol, XLogP of 2.59, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1,2-bis(4-methylsulfonylphenyl)pyrazolidine-3,5-dione is sourced from PubChem (CID 154289735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).