C8H15N3O2S — CID 154290813
4,4-diamino-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide (PubChem CID 154290813) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 4,4-diamino-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | 4,4-diamino-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 154290813 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 4,4-diamino-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)C1=CCC(N)(N)C=C1 |
| InChI | InChI=1S/C8H15N3O2S/c1-11(2)14(12,13)7-3-5-8(9,10)6-4-7/h3-5H,6,9-10H2,1-2H3 |
| InChIKey | LWEYFGOCVZYXTE-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|