C26H40N2O5 — CID 154292612
bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-hydroxybenzene-1,3-dicarboxylate (PubChem CID 154292612) has the molecular formula C26H40N2O5 and a molecular weight of 460.62 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-hydroxybenzene-1,3-dicarboxylate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-hydroxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 154292612 |
| Molecular Formula | C26H40N2O5 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-hydroxybenzene-1,3-dicarboxylate |
| SMILES | CC1(C)CC(OC(=O)c2cccc(C(=O)OC3CC(C)(C)NC(C)(C)C3)c2O)CC(C)(C)N1 |
| InChI | InChI=1S/C26H40N2O5/c1-23(2)12-16(13-24(3,4)27-23)32-21(30)18-10-9-11-19(20(18)29)22(31)33-17-14-25(5,6)28-26(7,8)15-17/h9-11,16-17,27-29H,12-15H2,1-8H3 |
| InChIKey | KVUMTYJLOBKFQU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |