About methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate
methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate (PubChem CID 15429263) has the molecular formula C23H21BrClNO2
and a molecular weight of 458.78 g/mol. Its IUPAC name is methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate |
| PubChem CID | 15429263 |
| Molecular Formula | C23H21BrClNO2 |
| Molecular Weight | 458.78 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Cl)cc2)c(-c2ccccc2)c2n1CC(C)(C)C2Br |
| InChI | InChI=1S/C23H21BrClNO2/c1-23(2)13-26-19(21(23)24)17(14-7-5-4-6-8-14)18(20(26)22(27)28-3)15-9-11-16(25)12-10-15/h4-12,21H,13H2,1-3H3 |
| InChIKey | WGYOAEPPJLUXRZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.78 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate?
The IUPAC name of methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate (CID 15429263) is methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate.
What is the SMILES notation for methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate?
The canonical SMILES for methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate is COC(=O)c1c(-c2ccc(Cl)cc2)c(-c2ccccc2)c2n1CC(C)(C)C2Br.
What is the InChIKey of methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate?
The InChIKey is WGYOAEPPJLUXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21BrClNO2/c1-23(2)13-26-19(21(23)24)17(14-7-5-4-6-8-14)18(20(26)22(27)28-3)15-9-11-16(25)12-10-15/h4-12,21H,13H2,1-3H3.
What are the key properties of methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate?
methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate has a molecular weight of 458.78 g/mol, XLogP of 6.74, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-bromo-2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizine-3-carboxylate is sourced from PubChem (CID 15429263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).