C5H7N3O — CID 154293252
4-methyl-1,6-dihydro-1,3,5-triazepin-7-one (PubChem CID 154293252) has the molecular formula C5H7N3O and a molecular weight of 125.13 g/mol. Its IUPAC name is 4-methyl-1,6-dihydro-1,3,5-triazepin-7-one.
| Compound Name | 4-methyl-1,6-dihydro-1,3,5-triazepin-7-one |
|---|---|
| PubChem CID | 154293252 |
| Molecular Formula | C5H7N3O |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 4-methyl-1,6-dihydro-1,3,5-triazepin-7-one |
| SMILES | CC1=NCC(=O)NC=N1 |
| InChI | InChI=1S/C5H7N3O/c1-4-6-2-5(9)8-3-7-4/h3H,2H2,1H3,(H,6,7,8,9) |
| InChIKey | MDAMMDYQJGAAHO-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |