C12H16O5 — CID 154293402
dimethyl 4-acetylcyclohexene-1,2-dicarboxylate (PubChem CID 154293402) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is dimethyl 4-acetylcyclohexene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-acetylcyclohexene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 154293402 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | dimethyl 4-acetylcyclohexene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC(C(C)=O)CC1 |
| InChI | InChI=1S/C12H16O5/c1-7(13)8-4-5-9(11(14)16-2)10(6-8)12(15)17-3/h8H,4-6H2,1-3H3 |
| InChIKey | DIUKRABMTSPDPU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |