About 2-aminobenzenesulfinyl fluoride
2-aminobenzenesulfinyl fluoride (PubChem CID 154293880) has the molecular formula C6H6FNOS
and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-aminobenzenesulfinyl fluoride.
Molecular Properties
| Compound Name | 2-aminobenzenesulfinyl fluoride |
| PubChem CID | 154293880 |
| Molecular Formula | C6H6FNOS |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | 2-aminobenzenesulfinyl fluoride |
| SMILES | Nc1ccccc1S(=O)F |
| InChI | InChI=1S/C6H6FNOS/c7-10(9)6-4-2-1-3-5(6)8/h1-4H,8H2 |
| InChIKey | KAITUYUQWQLACN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzenesulfinyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzenesulfinyl fluoride?
The IUPAC name of 2-aminobenzenesulfinyl fluoride (CID 154293880) is 2-aminobenzenesulfinyl fluoride.
What is the SMILES notation for 2-aminobenzenesulfinyl fluoride?
The canonical SMILES for 2-aminobenzenesulfinyl fluoride is Nc1ccccc1S(=O)F.
What is the InChIKey of 2-aminobenzenesulfinyl fluoride?
The InChIKey is KAITUYUQWQLACN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNOS/c7-10(9)6-4-2-1-3-5(6)8/h1-4H,8H2.
What are the key properties of 2-aminobenzenesulfinyl fluoride?
2-aminobenzenesulfinyl fluoride has a molecular weight of 159.19 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzenesulfinyl fluoride is sourced from PubChem (CID 154293880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).