About 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole
1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole (PubChem CID 15429395) has the molecular formula C26H26N4
and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole.
Molecular Properties
| Compound Name | 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole |
| PubChem CID | 15429395 |
| Molecular Formula | C26H26N4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole |
| SMILES | CCc1nn(C2CCCC2)c2cc(/C(=C/c3ccncc3)c3ccncc3)ccc12 |
| InChI | InChI=1S/C26H26N4/c1-2-25-23-8-7-21(18-26(23)30(29-25)22-5-3-4-6-22)24(20-11-15-28-16-12-20)17-19-9-13-27-14-10-19/h7-18,22H,2-6H2,1H3/b24-17+ |
| InChIKey | FQGNVJBVRRBMJD-JJIBRWJFSA-N |
| XLogP | 6.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole?
The IUPAC name of 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole (CID 15429395) is 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole.
What is the SMILES notation for 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole?
The canonical SMILES for 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole is CCc1nn(C2CCCC2)c2cc(/C(=C/c3ccncc3)c3ccncc3)ccc12.
What is the InChIKey of 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole?
The InChIKey is FQGNVJBVRRBMJD-JJIBRWJFSA-N. The full InChI is InChI=1S/C26H26N4/c1-2-25-23-8-7-21(18-26(23)30(29-25)22-5-3-4-6-22)24(20-11-15-28-16-12-20)17-19-9-13-27-14-10-19/h7-18,22H,2-6H2,1H3/b24-17+.
What are the key properties of 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole?
1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole has a molecular weight of 394.52 g/mol, XLogP of 6.09, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-6-[(Z)-1,2-dipyridin-4-ylethenyl]-3-ethylindazole is sourced from PubChem (CID 15429395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).